Products 1820717-41-6
CAS 1820717-41-6 is the registry number for 2-(Bromomethyl)-5-fluorobenzenesulphonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(bromomethyl)-5-fluorobenzenesulfonyl chloride (CAS 1820717-41-6) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: 2-(bromomethyl)-5-fluorobenzenesulfonyl chloride. InChIKey: SEMSWXJRNSFBAM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFO2S |
|---|---|
| Molecular weight | 287.53 g/mol |
| IUPAC name | 2-(bromomethyl)-5-fluorobenzenesulfonyl chloride |
| InChIKey | SEMSWXJRNSFBAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)CBr |
Computed by PubChem (NCBI)