CAS 1699542-31-8 appears in our catalog under these names: 4-Bromo-2-fluoro-3-methylbenzene-1-sulfonyl chloride, 95%, 4-Bromo-2-fluoro-3-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-bromo-2-fluoro-3-methylbenzenesulfonyl chloride (CAS 1699542-31-8) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methylbenzenesulfonyl chloride. InChIKey: OJZBTZIUENAEOK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFO2S |
|---|---|
| Molecular weight | 287.53 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-methylbenzenesulfonyl chloride |
| InChIKey | OJZBTZIUENAEOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)