Products 874804-12-3

CAS 874804-12-3 appears in our catalog under these names: 5-Bromo-4-fluoro-2-methylbenzene-1-sulfonyl chloride, 95%, 5-Bromo-4-fluoro-2-methylbenzenesulfonyl chloride, 95%, 5-Bromo-4-fluoro-2-methylbenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

5-bromo-4-fluoro-2-methylbenzenesulfonyl chloride (CAS 874804-12-3) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: 5-bromo-4-fluoro-2-methylbenzenesulfonyl chloride. InChIKey: KHORHAKUKQFFDV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClFO2S
Molecular weight287.53 g/mol
IUPAC name5-bromo-4-fluoro-2-methylbenzenesulfonyl chloride
InChIKeyKHORHAKUKQFFDV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)Br)F

Computed by PubChem (NCBI)