Products 1208076-97-4

CAS 1208076-97-4 appears in our catalog under these names: 4-Bromo-5-fluoro-2-methylbenzene-1-sulfonyl chloride, 95%, 4-Bromo-5-fluoro-2-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

4-bromo-5-fluoro-2-methylbenzenesulfonyl chloride (CAS 1208076-97-4) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: 4-bromo-5-fluoro-2-methylbenzenesulfonyl chloride. InChIKey: AFFPJHQMSGQUNK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClFO2S
Molecular weight287.53 g/mol
IUPAC name4-bromo-5-fluoro-2-methylbenzenesulfonyl chloride
InChIKeyAFFPJHQMSGQUNK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)F)Br

Computed by PubChem (NCBI)