CAS 874804-14-5 appears in our catalog under these names: 4-Bromo-2-fluoro-5-methylbenzenesulfonyl chloride, 96%, 4-Bromo-2-Fluoro-5-methylbenzene-1-sulfonyl chloride, 97%, 4-Bromo-2-fluoro-5-methylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 0,25g, 2,5g.
4-bromo-2-fluoro-5-methylbenzenesulfonyl chloride (CAS 874804-14-5) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: 4-bromo-2-fluoro-5-methylbenzenesulfonyl chloride. InChIKey: RXCNQBHYHBDBFV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFO2S |
|---|---|
| Molecular weight | 287.53 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-methylbenzenesulfonyl chloride |
| InChIKey | RXCNQBHYHBDBFV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)