Products 874804-14-5

CAS 874804-14-5 appears in our catalog under these names: 4-Bromo-2-fluoro-5-methylbenzenesulfonyl chloride, 96%, 4-Bromo-2-Fluoro-5-methylbenzene-1-sulfonyl chloride, 97%, 4-Bromo-2-fluoro-5-methylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 0,25g, 2,5g.

4-bromo-2-fluoro-5-methylbenzenesulfonyl chloride (CAS 874804-14-5) is a chemical compound with the molecular formula C7H5BrClFO2S and a molecular weight of 287.53 g/mol. IUPAC name: 4-bromo-2-fluoro-5-methylbenzenesulfonyl chloride. InChIKey: RXCNQBHYHBDBFV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClFO2S
Molecular weight287.53 g/mol
IUPAC name4-bromo-2-fluoro-5-methylbenzenesulfonyl chloride
InChIKeyRXCNQBHYHBDBFV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Br)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)