Products 890840-06-9
CAS 890840-06-9 is the registry number for 8-Fluoro-7-(trifluoromethyl)chroman-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-fluoro-7-(trifluoromethyl)-2,3-dihydrochromen-4-one (CAS 890840-06-9) is a chemical compound with the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. IUPAC name: 8-fluoro-7-(trifluoromethyl)-2,3-dihydrochromen-4-one. InChIKey: QMYBTXATPACYBF-UHFFFAOYSA-N.
| Molecular formula | C10H6F4O2 |
|---|---|
| Molecular weight | 234.15 g/mol |
| IUPAC name | 8-fluoro-7-(trifluoromethyl)-2,3-dihydrochromen-4-one |
| InChIKey | QMYBTXATPACYBF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2F)C(F)(F)F |
Computed by PubChem (NCBI)