Products 1184973-50-9
CAS 1184973-50-9 is the registry number for Carboxytolbutamide-d6. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg.
4-(1,1,2,2,3,3-hexadeuteriobutylcarbamoylsulfamoyl)benzoic acid (CAS 1184973-50-9) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 306.37 g/mol. IUPAC name: 4-(1,1,2,2,3,3-hexadeuteriobutylcarbamoylsulfamoyl)benzoic acid. InChIKey: GCMVATDSSHTCOS-KMQVRKNJSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 306.37 g/mol |
| IUPAC name | 4-(1,1,2,2,3,3-hexadeuteriobutylcarbamoylsulfamoyl)benzoic acid |
| InChIKey | GCMVATDSSHTCOS-KMQVRKNJSA-N |
| SMILES | [2H]C([2H])(C)C([2H])([2H])C([2H])([2H])NC(=O)NS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)