Products 1185019-82-2
CAS 1185019-82-2 is the registry number for 1-(2-Methoxy-4-nitrophenyl)-3-methyl-1H-1,2,4-triazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-methoxy-4-nitrophenyl)-3-methyl-1,2,4-triazole (CAS 1185019-82-2) is a chemical compound with the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. IUPAC name: 1-(2-methoxy-4-nitrophenyl)-3-methyl-1,2,4-triazole. InChIKey: CCLWURIPFUHRBY-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O3 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 1-(2-methoxy-4-nitrophenyl)-3-methyl-1,2,4-triazole |
| InChIKey | CCLWURIPFUHRBY-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=N1)C2=C(C=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)