CAS 1185033-05-9 is the registry number for N-Methyl-1-(2-quinoxalinyl)methanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
N-methyl-1-quinoxalin-2-ylmethanamine;oxalic acid (CAS 1185033-05-9) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: N-methyl-1-quinoxalin-2-ylmethanamine;oxalic acid. InChIKey: DVOSBKOTDUIQRV-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | N-methyl-1-quinoxalin-2-ylmethanamine;oxalic acid |
| InChIKey | DVOSBKOTDUIQRV-UHFFFAOYSA-N |
| SMILES | CNCC1=NC2=CC=CC=C2N=C1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)