Products 1185033-05-9

CAS 1185033-05-9 is the registry number for N-Methyl-1-(2-quinoxalinyl)methanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

N-methyl-1-quinoxalin-2-ylmethanamine;oxalic acid (CAS 1185033-05-9) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: N-methyl-1-quinoxalin-2-ylmethanamine;oxalic acid. InChIKey: DVOSBKOTDUIQRV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O4
Molecular weight263.25 g/mol
IUPAC nameN-methyl-1-quinoxalin-2-ylmethanamine;oxalic acid
InChIKeyDVOSBKOTDUIQRV-UHFFFAOYSA-N
SMILESCNCC1=NC2=CC=CC=C2N=C1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)