Products 914223-27-1
CAS 914223-27-1 appears in our catalog under these names: tert-Butyl 2-cyano-2-(5-nitropyridin-2-yl)acetate, 95%, tert-Butyl cyano(5-nitropyridin-2-yl)acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
Tert-butyl 2-cyano-2-(5-nitro-2-pyridinyl)acetate (CAS 914223-27-1) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 2-cyano-2-(5-nitro-2-pyridinyl)acetate. InChIKey: BQWLVUZTOGLWIG-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | tert-butyl 2-cyano-2-(5-nitro-2-pyridinyl)acetate |
| InChIKey | BQWLVUZTOGLWIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C#N)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)