Products 52531-94-9
CAS 52531-94-9 appears in our catalog under these names: 5,5-Dimethyl-3-(4-nitrobenzyl)imidazolidine-2,4-dione, 95%, 5,5-Dimethyl-3-(4-nitrobenzyl)imidazolidine-2,4-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg.
5,5-dimethyl-3-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione (CAS 52531-94-9) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: 5,5-dimethyl-3-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione. InChIKey: IGLOIBUWPRCLQJ-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 5,5-dimethyl-3-[(4-nitrophenyl)methyl]imidazolidine-2,4-dione |
| InChIKey | IGLOIBUWPRCLQJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CC2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)