Products 2133820-25-2

CAS 2133820-25-2 is the registry number for 3-Nitro-pyrrolo[3,2-b]pyridine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-nitropyrrolo[3,2-b]pyridine-1-carboxylate (CAS 2133820-25-2) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 3-nitropyrrolo[3,2-b]pyridine-1-carboxylate. InChIKey: MKULWHLJWHBYER-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O4
Molecular weight263.25 g/mol
IUPAC nametert-butyl 3-nitropyrrolo[3,2-b]pyridine-1-carboxylate
InChIKeyMKULWHLJWHBYER-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=C(C2=C1C=CC=N2)[N+](=O)[O-]

Computed by PubChem (NCBI)