CAS 2133820-25-2 is the registry number for 3-Nitro-pyrrolo[3,2-b]pyridine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl 3-nitropyrrolo[3,2-b]pyridine-1-carboxylate (CAS 2133820-25-2) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 3-nitropyrrolo[3,2-b]pyridine-1-carboxylate. InChIKey: MKULWHLJWHBYER-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | tert-butyl 3-nitropyrrolo[3,2-b]pyridine-1-carboxylate |
| InChIKey | MKULWHLJWHBYER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)