CAS 1351393-93-5 appears in our catalog under these names: 6-(5,7-Dioxo-5,7-dihydro-6h-pyrrolo[3,4-b]pyrazin-6-yl)hexanoic acid, 95%, 6-(5,7-DIoxo-5,7-dihydro-6h-pyrrolo(3,4-b)pyrazin-6-yl)hexanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanoic acid (CAS 1351393-93-5) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: 6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanoic acid. InChIKey: MLMMSDHTCKDTNO-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 6-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)hexanoic acid |
| InChIKey | MLMMSDHTCKDTNO-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=O)N(C2=O)CCCCCC(=O)O |
Computed by PubChem (NCBI)