Products 1255574-90-3
CAS 1255574-90-3 is the registry number for t-Butyl 2-cyano-2-(5-nitropyridin-2(1H)-ylidene)acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 2-cyano-2-(5-nitro-1H-pyridin-2-ylidene)acetate (CAS 1255574-90-3) is a chemical compound with the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. IUPAC name: tert-butyl 2-cyano-2-(5-nitro-1H-pyridin-2-ylidene)acetate. InChIKey: GMFFWYZEYQEJDE-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | tert-butyl 2-cyano-2-(5-nitro-1H-pyridin-2-ylidene)acetate |
| InChIKey | GMFFWYZEYQEJDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=C1C=CC(=CN1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)