Products 1185100-98-4
CAS 1185100-98-4 appears in our catalog under these names: N-(2-Methylbenzoyl)glycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, 2-Methyl Hippuric Acid-d2, >95% (HPLC), 2–Methyl Hippuric Acid–d2, 2-(2-Methylbenzamido)acetic acid-d2. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 1mg, 50mg, 1 mg, 10 mg.
2,2-dideuterio-2-[(2-methylbenzoyl)amino]acetic acid (CAS 1185100-98-4) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2,2-dideuterio-2-[(2-methylbenzoyl)amino]acetic acid. InChIKey: YOEBAVRJHRCKRE-NCYHJHSESA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2,2-dideuterio-2-[(2-methylbenzoyl)amino]acetic acid |
| InChIKey | YOEBAVRJHRCKRE-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)C1=CC=CC=C1C |
Computed by PubChem (NCBI)