Products 1216430-90-8
CAS 1216430-90-8 appears in our catalog under these names: 2-Methyl Hippuric Acid-d7, >95% (HPLC), N-(2-Methyl-d3-benzoyl-d4)glycine, 98 atom % D, min 98% Chemical Purity, 2–(2–Methylbenzamido)acetic acid–d7, 2-(2-Methylbenzamido)acetic acid-d7, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 10mg, 25mg, 25 mg, 5 mg.
2-[[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzoyl]amino]acetic acid (CAS 1216430-90-8) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 200.24 g/mol. IUPAC name: 2-[[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzoyl]amino]acetic acid. InChIKey: YOEBAVRJHRCKRE-AAYPNNLASA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 2-[[2,3,4,5-tetradeuterio-6-(trideuteriomethyl)benzoyl]amino]acetic acid |
| InChIKey | YOEBAVRJHRCKRE-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)NCC(=O)O)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)