CAS 1185239-64-8 appears in our catalog under these names: Stiripentol-d9, Stiripentol-d9, >95% (HPLC), Stiripentol–d9. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
(E)-1-(1,3-benzodioxol-5-yl)-5,5,5-trideuterio-4,4-bis(trideuteriomethyl)pent-1-en-3-ol (CAS 1185239-64-8) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 243.35 g/mol. IUPAC name: (E)-1-(1,3-benzodioxol-5-yl)-5,5,5-trideuterio-4,4-bis(trideuteriomethyl)pent-1-en-3-ol. InChIKey: IBLNKMRFIPWSOY-QPYRMXHWSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 243.35 g/mol |
| IUPAC name | (E)-1-(1,3-benzodioxol-5-yl)-5,5,5-trideuterio-4,4-bis(trideuteriomethyl)pent-1-en-3-ol |
| InChIKey | IBLNKMRFIPWSOY-QPYRMXHWSA-N |
| SMILES | [2H]C([2H])([2H])C(C(/C=C/C1=CC2=C(C=C1)OCO2)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)