CAS 144017-65-2 appears in our catalog under these names: (R)-Stiripentol, (R)-Stiripentol-d9. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(E,3R)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol (CAS 144017-65-2) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: (E,3R)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol. InChIKey: IBLNKMRFIPWSOY-VUDGCMKMSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | (E,3R)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol |
| InChIKey | IBLNKMRFIPWSOY-VUDGCMKMSA-N |
| SMILES | CC(C)(C)[C@@H](/C=C/C1=CC2=C(C=C1)OCO2)O |
Computed by PubChem (NCBI)