CAS 1185247-70-4 appears in our catalog under these names: RESVERATROL-(4-HYDROXYPHENYL-13C6), 99 A, Resveratrol-13C6, 98% 98%atom%13C, Resveratrol-13C6, >95% (HPLC), (E/Z)-Resveratrol-13C6, 98.78%. Offered by: Sigma-Aldrich, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 10MG, 1MG, on request, 5mg, 1 mg.
5-[(E)-2-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ethenyl]benzene-1,3-diol (CAS 1185247-70-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 234.20 g/mol. IUPAC name: 5-[(E)-2-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ethenyl]benzene-1,3-diol. InChIKey: LUKBXSAWLPMMSZ-OYESDQHJSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 5-[(E)-2-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ethenyl]benzene-1,3-diol |
| InChIKey | LUKBXSAWLPMMSZ-OYESDQHJSA-N |
| SMILES | C1=C(C=C(C=C1O)O)/C=C/[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)O |
Computed by PubChem (NCBI)