Products 1185293-71-3

CAS 1185293-71-3 is the registry number for [3-(3,5-Dimethyl-1h-pyrazol-1-yl)propyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethylpyrazol-1-yl)propan-1-amine;dihydrochloride (CAS 1185293-71-3) is a chemical compound with the molecular formula C8H17Cl2N3 and a molecular weight of 226.14 g/mol. IUPAC name: 3-(3,5-dimethylpyrazol-1-yl)propan-1-amine;dihydrochloride. InChIKey: KAYWQJQXFQNLMD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17Cl2N3
Molecular weight226.14 g/mol
IUPAC name3-(3,5-dimethylpyrazol-1-yl)propan-1-amine;dihydrochloride
InChIKeyKAYWQJQXFQNLMD-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CCCN)C.Cl.Cl

Computed by PubChem (NCBI)