CAS 188638-90-6 is the registry number for 2-(2-Isopropyl-1H-imidazol-4-yl)ethanamine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-(2-propan-2-yl-1H-imidazol-5-yl)ethanamine;dihydrochloride (CAS 188638-90-6) is a chemical compound with the molecular formula C8H17Cl2N3 and a molecular weight of 226.14 g/mol. IUPAC name: 2-(2-propan-2-yl-1H-imidazol-5-yl)ethanamine;dihydrochloride. InChIKey: VQBTYZLBIJQCDT-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N3 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 2-(2-propan-2-yl-1H-imidazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | VQBTYZLBIJQCDT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=C(N1)CCN.Cl.Cl |
Computed by PubChem (NCBI)