CAS 1240134-33-1 is the registry number for 1-(3,5-Dimethyl-1h-pyrazol-4-yl)-N-methylethan-1-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methylethanamine;dihydrochloride (CAS 1240134-33-1) is a chemical compound with the molecular formula C8H17Cl2N3 and a molecular weight of 226.14 g/mol. IUPAC name: 1-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methylethanamine;dihydrochloride. InChIKey: NQZVHDSHZLFNJZ-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N3 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-N-methylethanamine;dihydrochloride |
| InChIKey | NQZVHDSHZLFNJZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C(C)NC.Cl.Cl |
Computed by PubChem (NCBI)