CAS 2173992-00-0 appears in our catalog under these names: 2-Methyl-1-(1-methyl-1h-pyrazol-4-yl)propan-1-amine dihydrochloride, 95%, 2-Methyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
2-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine;dihydrochloride (CAS 2173992-00-0) is a chemical compound with the molecular formula C8H17Cl2N3 and a molecular weight of 226.14 g/mol. IUPAC name: 2-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine;dihydrochloride. InChIKey: WYWFKJPONLCTPG-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N3 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 2-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine;dihydrochloride |
| InChIKey | WYWFKJPONLCTPG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CN(N=C1)C)N.Cl.Cl |
Computed by PubChem (NCBI)