CAS 2287312-97-2 appears in our catalog under these names: 2-(Trimethyl-1h-pyrazol-1-yl)ethan-1-amine dihydrochloride, 95%, 2-(3,4,5-Trimethyl-1H-pyrazol-1-yl)ethan-1-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-(3,4,5-trimethylpyrazol-1-yl)ethanamine;dihydrochloride (CAS 2287312-97-2) is a chemical compound with the molecular formula C8H17Cl2N3 and a molecular weight of 226.14 g/mol. IUPAC name: 2-(3,4,5-trimethylpyrazol-1-yl)ethanamine;dihydrochloride. InChIKey: OIBGILHXRFCUMQ-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N3 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | 2-(3,4,5-trimethylpyrazol-1-yl)ethanamine;dihydrochloride |
| InChIKey | OIBGILHXRFCUMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C)CCN)C.Cl.Cl |
Computed by PubChem (NCBI)