CAS 2094301-50-3 is the registry number for methyl[(trimethyl-1h-pyrazol-4-yl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine;dihydrochloride (CAS 2094301-50-3) is a chemical compound with the molecular formula C8H17Cl2N3 and a molecular weight of 226.14 g/mol. IUPAC name: N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine;dihydrochloride. InChIKey: FNULNIBHLKFVLQ-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2N3 |
|---|---|
| Molecular weight | 226.14 g/mol |
| IUPAC name | N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)methanamine;dihydrochloride |
| InChIKey | FNULNIBHLKFVLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)CNC.Cl.Cl |
Computed by PubChem (NCBI)