CAS 1185318-60-8 is the registry number for 1–Chloro–4–(n–propyl–d7)–phthalazine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
1-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)phthalazine (CAS 1185318-60-8) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 213.71 g/mol. IUPAC name: 1-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)phthalazine. InChIKey: JNGLMHGHPZJICJ-KSWAKBPNSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 213.71 g/mol |
| IUPAC name | 1-chloro-4-(1,1,2,2,3,3,3-heptadeuteriopropyl)phthalazine |
| InChIKey | JNGLMHGHPZJICJ-KSWAKBPNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)