CAS 1186202-25-4 appears in our catalog under these names: 6,8-Dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid, 95%, 6,8–dioxo–5,7–diazaspiro(3·4)octane–2–carboxylic acid, 6,8-dioxo-5,7-diazaspiro(3.4)octane-2-carboxylic acid, 6,8-Dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid (CAS 1186202-25-4) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid. InChIKey: VAXRLMKVUWPROQ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 6,8-dioxo-5,7-diazaspiro[3.4]octane-2-carboxylic acid |
| InChIKey | VAXRLMKVUWPROQ-UHFFFAOYSA-N |
| SMILES | C1C(CC12C(=O)NC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)