CAS 1186327-75-2 is the registry number for 2-(Hydroxy-(2-nitrophenyl)methyl)cyclopentanone. Offered by: TRC. Available pack sizes: 750mg.
2-[hydroxy-(2-nitrophenyl)methyl]cyclopentan-1-one (CAS 1186327-75-2) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 2-[hydroxy-(2-nitrophenyl)methyl]cyclopentan-1-one. InChIKey: JOELUJCLBZDDSS-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-[hydroxy-(2-nitrophenyl)methyl]cyclopentan-1-one |
| InChIKey | JOELUJCLBZDDSS-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C1)C(C2=CC=CC=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)