Products 1186518-98-8
CAS 1186518-98-8 appears in our catalog under these names: 3-Bromo-5-(methylsulfonyl)benzoic acid, 95%, 3–Bromo–5–(methylsulfonyl)benzoic Acid, 3-bromo-5-methanesulfonylbenzoic acid, 3-Bromo-5-(methylsulfonyl)benzoic acid, ≥95%, ≥95%, 3-Bromo-5-(methylsulfonyl)benzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-bromo-5-methylsulfonylbenzoic acid (CAS 1186518-98-8) is a chemical compound with the molecular formula C8H7BrO4S and a molecular weight of 279.11 g/mol. IUPAC name: 3-bromo-5-methylsulfonylbenzoic acid. InChIKey: SGQDIUIVEWBSEB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4S |
|---|---|
| Molecular weight | 279.11 g/mol |
| IUPAC name | 3-bromo-5-methylsulfonylbenzoic acid |
| InChIKey | SGQDIUIVEWBSEB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)