Products 39058-84-9
CAS 39058-84-9 appears in our catalog under these names: 3-Bromo-4-(methylsulfonyl)benzoic acid, 97%, 3–Bromo–4–(methylsulfonyl)benzoic Acid, 3-Bromo-4-(methylsulfonyl)benzoic acid, 3-Bromo-4-(methylsulfonyl)benzoic acid 97%, 3-Bromo-4-(methylsulfonyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g, 10g.
3-bromo-4-methylsulfonylbenzoic acid (CAS 39058-84-9) is a chemical compound with the molecular formula C8H7BrO4S and a molecular weight of 279.11 g/mol. IUPAC name: 3-bromo-4-methylsulfonylbenzoic acid. InChIKey: KTVNPQRQWOOMGI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4S |
|---|---|
| Molecular weight | 279.11 g/mol |
| IUPAC name | 3-bromo-4-methylsulfonylbenzoic acid |
| InChIKey | KTVNPQRQWOOMGI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)