CAS 146431-33-6 appears in our catalog under these names: 5–Bromo–2–(methylsulfonyl)benzoic acid, 5-Bromo-2-(methylsulfonyl)benzoic acid, 5-Bromo-2-(methylsulfonyl)benzoic acid 95%, 5-Bromo-2-(methylsulfonyl)benzoic acid, 95%, 95%, 5-Bromo-2-(methylsulfonyl)benzoic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
5-bromo-2-methylsulfonylbenzoic acid (CAS 146431-33-6) is a chemical compound with the molecular formula C8H7BrO4S and a molecular weight of 279.11 g/mol. IUPAC name: 5-bromo-2-methylsulfonylbenzoic acid. InChIKey: HUGYEDOXFXCAGW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4S |
|---|---|
| Molecular weight | 279.11 g/mol |
| IUPAC name | 5-bromo-2-methylsulfonylbenzoic acid |
| InChIKey | HUGYEDOXFXCAGW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)