Products 3937-93-7

CAS 3937-93-7 is the registry number for 2-(3-Bromobenzenesulfonyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-(3-bromophenyl)sulfonylacetic acid (CAS 3937-93-7) is a chemical compound with the molecular formula C8H7BrO4S and a molecular weight of 279.11 g/mol. IUPAC name: 2-(3-bromophenyl)sulfonylacetic acid. InChIKey: PXONNCWYTKBDGW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO4S
Molecular weight279.11 g/mol
IUPAC name2-(3-bromophenyl)sulfonylacetic acid
InChIKeyPXONNCWYTKBDGW-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Br)S(=O)(=O)CC(=O)O

Computed by PubChem (NCBI)