Products 22361-59-7

CAS 22361-59-7 is the registry number for 2-Bromo-5-methanesulfonylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-bromo-5-methylsulfonylbenzoic acid (CAS 22361-59-7) is a chemical compound with the molecular formula C8H7BrO4S and a molecular weight of 279.11 g/mol. IUPAC name: 2-bromo-5-methylsulfonylbenzoic acid. InChIKey: GBPWZXIQYSSWQC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO4S
Molecular weight279.11 g/mol
IUPAC name2-bromo-5-methylsulfonylbenzoic acid
InChIKeyGBPWZXIQYSSWQC-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=C(C=C1)Br)C(=O)O

Computed by PubChem (NCBI)