CAS 3406-73-3 is the registry number for 2-(4-Bromobenzenesulfonyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(4-bromophenyl)sulfonylacetic acid (CAS 3406-73-3) is a chemical compound with the molecular formula C8H7BrO4S and a molecular weight of 279.11 g/mol. IUPAC name: 2-(4-bromophenyl)sulfonylacetic acid. InChIKey: WPKAKCLFPYNNLQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4S |
|---|---|
| Molecular weight | 279.11 g/mol |
| IUPAC name | 2-(4-bromophenyl)sulfonylacetic acid |
| InChIKey | WPKAKCLFPYNNLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CC(=O)O)Br |
Computed by PubChem (NCBI)