CAS 1186526-91-9 appears in our catalog under these names: 2’-Deoxy Cytidine-5,6-d2, >95% (HPLC), 2'deoxycytidine-5,6-d2, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 1mg, 5mg, 0,01g.
5,6-dideuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyrimidin-2-one (CAS 1186526-91-9) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 229.23 g/mol. IUPAC name: 5,6-dideuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyrimidin-2-one. InChIKey: CKTSBUTUHBMZGZ-AQAQJVFASA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 5,6-dideuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyrimidin-2-one |
| InChIKey | CKTSBUTUHBMZGZ-AQAQJVFASA-N |
| SMILES | [2H]C1=C(N(C(=O)NC1=N)[C@H]2C[C@@H]([C@H](O2)CO)O)[2H] |
Computed by PubChem (NCBI)