CAS 25352-61-8 is the registry number for 2'-Deoxy Cytidine-5-d1. Offered by: TRC. Available pack sizes: 100mg.
5-deuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyrimidin-2-one (CAS 25352-61-8) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 228.22 g/mol. IUPAC name: 5-deuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyrimidin-2-one. InChIKey: CKTSBUTUHBMZGZ-GFVXGUDPSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 5-deuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyrimidin-2-one |
| InChIKey | CKTSBUTUHBMZGZ-GFVXGUDPSA-N |
| SMILES | [2H]C1=CN(C(=O)NC1=N)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)