CAS 1987883-22-6 appears in our catalog under these names: 2'–Deoxycytidine–13C9,15N3, 2'-Deoxycytidine-13C9,15N3, 99.00%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg (100mM * 41,82μl in water), 1 mg (100 mM * 41.82 μL in Water), 10 mg (100 mM * 418.18 μL in Water), 5 mg (100 mM * 209.09 μL in Water).
4-(15N)azanyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl](2,5,6-13C3,1,3-15N2)pyrimidin-2-one (CAS 1987883-22-6) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 238.14 g/mol. IUPAC name: 4-(15N)azanyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl](2,5,6-13C3,1,3-15N2)pyrimidin-2-one. InChIKey: CKTSBUTUHBMZGZ-XHBGBPFNSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 4-(15N)azanyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl](2,5,6-13C3,1,3-15N2)pyrimidin-2-one |
| InChIKey | CKTSBUTUHBMZGZ-XHBGBPFNSA-N |
| SMILES | [13CH2]1[13C@@H]([13C@H](O[13C@H]1[15N]2[13CH]=[13CH]C(=[15N][13C]2=O)[15NH2])[13CH2]O)O |
Computed by PubChem (NCBI)