Products 135333-27-6
CAS 135333-27-6 appears in our catalog under these names: 4-Bromomethcathinone Hydrochloride, Brefedrone Hydrochloride (4-Bromomethcathinone Hydrochloride, 4-BMC HCl). Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 250mg, 10mg, 50mg, 25mg.
1-(4-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 135333-27-6) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 1-(4-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: TYWLEEFTZLMGNE-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | TYWLEEFTZLMGNE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Br)NC.Cl |
Computed by PubChem (NCBI)