Products 676487-42-6
CAS 676487-42-6 appears in our catalog under these names: 3-Bromomethcathinone Hydrochloride, 1-(3-Bromophenyl)-2-(methylamino)propan-1-one hydrochloride, 3-BMC (hydrochloride), 99.9%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 50mg, 100mg, 25 mg, 10 mg, 50 mg, 5 mg.
1-(3-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 676487-42-6) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 1-(3-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: HNHVECYNAJJZIQ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | HNHVECYNAJJZIQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Br)NC.Cl |
Computed by PubChem (NCBI)