Products 1187318-52-0
CAS 1187318-52-0 appears in our catalog under these names: 3-Bromo-5-fluoro-2-methylbenzoic acid, 95%, 3-Bromo-5-fluoro-2-methylbenzoic acid, 97%, 3–Bromo–5–fluoro–2–methylbenzoic acid, 3-Bromo-5-fluoro-2-methylbenzoic acid, 3-Bromo-5-fluoro-2-methylbenzoic acid 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g, 10g, 25g, 500mg.
3-bromo-5-fluoro-2-methylbenzoic acid (CAS 1187318-52-0) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-5-fluoro-2-methylbenzoic acid. InChIKey: AAKUFRPQXGQYHN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-methylbenzoic acid |
| InChIKey | AAKUFRPQXGQYHN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)F)C(=O)O |
Computed by PubChem (NCBI)