CAS 1187368-67-7 appears in our catalog under these names: 4-Amino-2-fluoro-n,n-dimethylbenzamide, 95%, Enzalutamide Impurity 29, 4-amino-2-fluoro-N,N-dimethylbenzamide. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
4-amino-2-fluoro-N,N-dimethylbenzamide (CAS 1187368-67-7) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 4-amino-2-fluoro-N,N-dimethylbenzamide. InChIKey: YGAFUPNFKVHPOM-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 4-amino-2-fluoro-N,N-dimethylbenzamide |
| InChIKey | YGAFUPNFKVHPOM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)