CAS 1187928-39-7 appears in our catalog under these names: [2-(2-Amino-phenyl)-thiazol-4-yl]-methanol hydrochloride, 95%, (2-(2-Aminophenyl)thiazol-4-yl)methanol hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[2-(2-aminophenyl)-1,3-thiazol-4-yl]methanol;hydrochloride (CAS 1187928-39-7) is a chemical compound with the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. IUPAC name: [2-(2-aminophenyl)-1,3-thiazol-4-yl]methanol;hydrochloride. InChIKey: BHFIUQUJAMXSHS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2OS |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | [2-(2-aminophenyl)-1,3-thiazol-4-yl]methanol;hydrochloride |
| InChIKey | BHFIUQUJAMXSHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)CO)N.Cl |
Computed by PubChem (NCBI)