CAS 742118-88-3 appears in our catalog under these names: 2-(1-Chloroethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4(3h)-one, 95%, 2-(1-Chloroethyl)-5,6-dimethyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(1-chloroethyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 742118-88-3) is a chemical compound with the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. IUPAC name: 2-(1-chloroethyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: FUAYKDNIULHSBI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2OS |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | 2-(1-chloroethyl)-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | FUAYKDNIULHSBI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)C(C)Cl)C |
Computed by PubChem (NCBI)