Products 937700-28-2
CAS 937700-28-2 is the registry number for 2-Chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide (CAS 937700-28-2) is a chemical compound with the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. IUPAC name: 2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide. InChIKey: GXBWILVUQODNPZ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2OS |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | 2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide |
| InChIKey | GXBWILVUQODNPZ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C#N)NC(=O)C(C)Cl)C |
Computed by PubChem (NCBI)