Products 94830-65-6
CAS 94830-65-6 appears in our catalog under these names: 4-(phenoxymethyl)-1,3-thiazol-2-amine hydrochloride, 95%, 4-(Phenoxymethyl)-1，3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
4-(phenoxymethyl)-1,3-thiazol-2-amine;hydrochloride (CAS 94830-65-6) is a chemical compound with the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. IUPAC name: 4-(phenoxymethyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: FLEPWMUYUITNHJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2OS |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | 4-(phenoxymethyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | FLEPWMUYUITNHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CSC(=N2)N.Cl |
Computed by PubChem (NCBI)