CAS 1211284-37-5 appears in our catalog under these names: 3-(1,3-Benzothiazol-2-yl)oxetan-3-amine hydrochloride, 95%, 3-(1,3-Benzothiazol-2-yl)oxetan-3-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(1,3-benzothiazol-2-yl)oxetan-3-amine;hydrochloride (CAS 1211284-37-5) is a chemical compound with the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)oxetan-3-amine;hydrochloride. InChIKey: JMPOAAHYJMIGDU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2OS |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-yl)oxetan-3-amine;hydrochloride |
| InChIKey | JMPOAAHYJMIGDU-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=NC3=CC=CC=C3S2)N.Cl |
Computed by PubChem (NCBI)