CAS 796106-51-9 is the registry number for 2-(Chloromethyl)-5-(5-ethyl-4-methylthiophen-2-yl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(chloromethyl)-5-(5-ethyl-4-methylthiophen-2-yl)-1,3,4-oxadiazole (CAS 796106-51-9) is a chemical compound with the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. IUPAC name: 2-(chloromethyl)-5-(5-ethyl-4-methylthiophen-2-yl)-1,3,4-oxadiazole. InChIKey: OTZYRHCUUAKIJP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2OS |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(5-ethyl-4-methylthiophen-2-yl)-1,3,4-oxadiazole |
| InChIKey | OTZYRHCUUAKIJP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(S1)C2=NN=C(O2)CCl)C |
Computed by PubChem (NCBI)