Products 1784111-07-4
CAS 1784111-07-4 appears in our catalog under these names: 6-Bromo-1,3-benzothiazole-4-carboxylic acid, 6-Bromobenzo[d]thiazole-4-carboxylic acid 95%, 6-Bromobenzo[d]thiazole-4-carboxylic acid, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
6-bromo-1,3-benzothiazole-4-carboxylic acid (CAS 1784111-07-4) is a chemical compound with the molecular formula C8H4BrNO2S and a molecular weight of 258.09 g/mol. IUPAC name: 6-bromo-1,3-benzothiazole-4-carboxylic acid. InChIKey: HUOFBUMVRCPMED-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2S |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 6-bromo-1,3-benzothiazole-4-carboxylic acid |
| InChIKey | HUOFBUMVRCPMED-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)N=CS2)Br |
Computed by PubChem (NCBI)