CAS 336105-45-4 is the registry number for (S)-2,2,2-trifluoro-1-(pyridin-2-yl)ethan-1-amine hcl, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1S)-2,2,2-trifluoro-1-pyridin-2-ylethanamine;hydrochloride (CAS 336105-45-4) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-pyridin-2-ylethanamine;hydrochloride. InChIKey: CQZMNGPRQBZYSO-RGMNGODLSA-N.
| Molecular formula | C7H8ClF3N2 |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-pyridin-2-ylethanamine;hydrochloride |
| InChIKey | CQZMNGPRQBZYSO-RGMNGODLSA-N |
| SMILES | C1=CC=NC(=C1)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)