Products 1187984-10-6
CAS 1187984-10-6 is the registry number for 8-(Trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 1187984-10-6) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 8-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: MZAVJMWMCIMGNZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 8-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | MZAVJMWMCIMGNZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC(=C2O1)C(F)(F)F |
Computed by PubChem (NCBI)